Z-Gln(Trt)-OH structure
|
Common Name | Z-Gln(Trt)-OH | ||
|---|---|---|---|---|
| CAS Number | 132388-60-4 | Molecular Weight | 522.591 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 792.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C32H30N2O5 | Melting Point | 160-1650ºC | |
| MSDS | N/A | Flash Point | 433.2±32.9 °C | |
| Name | (2S)-5-oxo-2-(phenylmethoxycarbonylamino)-5-(tritylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 792.6±60.0 °C at 760 mmHg |
| Melting Point | 160-1650ºC |
| Molecular Formula | C32H30N2O5 |
| Molecular Weight | 522.591 |
| Flash Point | 433.2±32.9 °C |
| Exact Mass | 522.215454 |
| PSA | 104.73000 |
| LogP | 6.26 |
| Vapour Pressure | 0.0±2.9 mmHg at 25°C |
| Index of Refraction | 1.613 |
| InChIKey | MYOAIKMOWHPBQS-NDEPHWFRSA-N |
| SMILES | O=C(CCC(NC(=O)OCc1ccccc1)C(=O)O)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| Storage condition | -15°C |
|
~72%
Z-Gln(Trt)-OH CAS#:132388-60-4 |
| Literature: Journal of the American Chemical Society, , vol. 135, # 35 p. 12998 - 13007 |
| L-Glutamine, N-[(phenylmethoxy)carbonyl]-N-(triphenylmethyl)- |
| N-[(Benzyloxy)carbonyl]-N-trityl-L-glutamine |
| MFCD00144845 |
| N-Cbz-L-Gln(Tr)-OH |
| Z-Gln(Trt)-OH |
| (((benzyloxy)carbonyl)amino)-5-oxo-5-(tritylamino)pentanoic acid |
| Z-L-Gln(Trt)-OH |
| (S)-2-(((Benzyloxy)carbonyl)amino)-5-oxo-5-(tritylamino)pentanoic acid |
| N-Cbz-Gln(Trt)-OH |
| n-cbz-n'-trityl-l-glutamine |