Boc-Gln(Trt)-OH structure
|
Common Name | Boc-Gln(Trt)-OH | ||
|---|---|---|---|---|
| CAS Number | 132388-69-3 | Molecular Weight | 488.575 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 728.9±60.0 °C at 760 mmHg | |
| Molecular Formula | C29H32N2O5 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 394.6±32.9 °C | |
| Name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(tritylamino)pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 728.9±60.0 °C at 760 mmHg |
| Molecular Formula | C29H32N2O5 |
| Molecular Weight | 488.575 |
| Flash Point | 394.6±32.9 °C |
| Exact Mass | 488.231110 |
| PSA | 104.73000 |
| LogP | 5.64 |
| Vapour Pressure | 0.0±2.5 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | YEXNCDUSVVLUFM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CCC(=O)NC(c1ccccc1)(c1ccccc1)c1ccccc1)C(=O)O |
| Storage condition | Store at RT. |
|
~%
Boc-Gln(Trt)-OH CAS#:132388-69-3 |
| Literature: Tetrahedron Letters, , vol. 32, # 6 p. 739 - 742 |
|
~%
Boc-Gln(Trt)-OH CAS#:132388-69-3 |
| Literature: Tetrahedron Letters, , vol. 32, # 6 p. 739 - 742 |
|
~%
Boc-Gln(Trt)-OH CAS#:132388-69-3 |
| Literature: Tetrahedron Letters, , vol. 32, # 6 p. 739 - 742 |
|
~%
Boc-Gln(Trt)-OH CAS#:132388-69-3 |
| Literature: Tetrahedron Letters, , vol. 32, # 6 p. 739 - 742 |
|
~%
Boc-Gln(Trt)-OH CAS#:132388-69-3 |
| Literature: Tetrahedron Letters, , vol. 32, # 6 p. 739 - 742 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-Boc-N'-trityl-L-glutamine |
| N-{[(2-Methyl-2-propanyl)oxy]carbonyl}-N-trityl-L-glutamine |
| MFCD00153305 |
| L-Glutamine, N-[(1,1-dimethylethoxy)carbonyl]-N-(triphenylmethyl)- |
| Boc-L-Gln(Trt)-OH |
| Boc-Gln(Trt)-OH |
| N-(tert-Butoxycarbonyl)-N-trityl-L-glutamine |
| N-Boc-N-trityl-L-glutamine |
| Nalpha-Boc-Ndelta-trityl-L-glutamine |