2,3,4-tri-O-acetyl-1,6-anhydromannopyranose structure
|
Common Name | 2,3,4-tri-O-acetyl-1,6-anhydromannopyranose | ||
|---|---|---|---|---|
| CAS Number | 13242-48-3 | Molecular Weight | 288.25100 | |
| Density | 1.34g/cm3 | Boiling Point | 392ºC at 760mmHg | |
| Molecular Formula | C12H16O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.4ºC | |
| Name | [(1S,2R,3S,4S,5S)-3,4-diacetyloxy-6,8-dioxabicyclo[3.2.1]octan-2-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 392ºC at 760mmHg |
| Molecular Formula | C12H16O8 |
| Molecular Weight | 288.25100 |
| Flash Point | 147.4ºC |
| Exact Mass | 288.08500 |
| PSA | 97.36000 |
| Vapour Pressure | 2.37E-06mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | BAKQMOSGYGQJOJ-OSUNSFLBSA-N |
| SMILES | CC(=O)OC1C2COC(O2)C(OC(C)=O)C1OC(C)=O |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| mannosan triacetate |
| 2,3,4-Triac-ahman |
| 2,3,4-Tri-O-acetyl-1,6-anhydro-D-mannopyranose |
| 2,3,4-Tri-O-acetyl-1,6-anhydromannopyranose |