boc-l-beta-homoleucine structure
|
Common Name | boc-l-beta-homoleucine | ||
|---|---|---|---|---|
| CAS Number | 132549-43-0 | Molecular Weight | 245.315 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 374.3±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H23NO4 | Melting Point | 53-55℃ | |
| MSDS | USA | Flash Point | 180.2±23.2 °C | |
| Name | (3S)-5-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 374.3±25.0 °C at 760 mmHg |
| Melting Point | 53-55℃ |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.315 |
| Flash Point | 180.2±23.2 °C |
| Exact Mass | 245.162704 |
| PSA | 75.63000 |
| LogP | 2.68 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | XRVAMBSTOWHUMM-VIFPVBQESA-N |
| SMILES | CC(C)CC(CC(=O)O)NC(=O)OC(C)(C)C |
| Storage condition | 2-8°C |
| Water Solubility | Very slightly soluble (1.1 g/L at 25°C). |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | 24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29241990 |
|
M. Rodriguez et al.
Tetrahedron Lett. 31 , 7319, (1990)
|
|
|
D. Seebach et al.
Helv. Chim. Acta 79 , 913, (1996)
|
|
|
Helv. Chim. Acta 79 , 2043, (1996)
|
| AmbotzBAA6190 |
| (S)-3-(Boc-amino)-5-methylhexanoic acid |
| (3S)-5-Methyl-3-({[(2-methyl-2-propanyl)oxy]carbonyl}amino)hexanoic acid |
| (S)-3-{[(tert-butoxy)carbonyl]amino}-5-methylhexanoic acid |
| Boc-β-Homoleu-OH |
| MFCD02101665 |
| Hexanoic acid, 3-[[(1,1-dimethylethoxy)carbonyl]amino]-5-methyl-, (3S)- |
| Boc-L-beta-homoleucine |