9H-Purin-6-amine,9-(2-deoxy-b-D-threo-pentofuranosyl)- structure
|
Common Name | 9H-Purin-6-amine,9-(2-deoxy-b-D-threo-pentofuranosyl)- | ||
|---|---|---|---|---|
| CAS Number | 13276-53-4 | Molecular Weight | 251.24 | |
| Density | 1.91g/cm3 | Boiling Point | 627.2ºC at 760 mmHg | |
| Molecular Formula | C10H13N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 333.1ºC | |
Use of 9H-Purin-6-amine,9-(2-deoxy-b-D-threo-pentofuranosyl)-9-(2-Deoxy-β-D-threo-pentofuranosyl)-9H-purin-6-amine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 5-(6-aminopurin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| Synonym | More Synonyms |
| Description | 9-(2-Deoxy-β-D-threo-pentofuranosyl)-9H-purin-6-amine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.91g/cm3 |
|---|---|
| Boiling Point | 627.2ºC at 760 mmHg |
| Molecular Formula | C10H13N5O3 |
| Molecular Weight | 251.24 |
| Flash Point | 333.1ºC |
| Exact Mass | 251.10200 |
| PSA | 119.31000 |
| Vapour Pressure | 1.36E-16mmHg at 25°C |
| Index of Refraction | 1.863 |
| InChIKey | OLXZPDWKRNYJJZ-FSDSQADBSA-N |
| SMILES | Nc1ncnc2c1ncn2C1CC(O)C(CO)O1 |
| HS Code | 2934999090 |
|---|
| Precursor 10 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2'-Desoxy-adenosin |