Anhydro nucleoside structure
|
Common Name | Anhydro nucleoside | ||
|---|---|---|---|---|
| CAS Number | 132776-19-3 | Molecular Weight | 346.31000 | |
| Density | N/A | Boiling Point | 475.3ºC at 760 mmHg | |
| Molecular Formula | C17H15FN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.3ºC | |
| Name | Anhydro nucleoside |
|---|
| Boiling Point | 475.3ºC at 760 mmHg |
|---|---|
| Molecular Formula | C17H15FN2O5 |
| Molecular Weight | 346.31000 |
| Flash Point | 241.3ºC |
| Exact Mass | 346.09600 |
| PSA | 79.65000 |
| LogP | 1.40520 |
| Vapour Pressure | 3.35E-09mmHg at 25°C |
| Index of Refraction | 1.666 |
| InChIKey | UMDFLFHAXYPYQN-UKTARXLSSA-N |
| SMILES | Cc1cn2c(nc1=O)OC1C(COC(=O)c3ccccc3)OC2C1F |
|
~%
Anhydro nucleoside CAS#:132776-19-3 |
| Literature: Huang; Chen; Wang; Kim; Warshaw; Armstrong; Zhu; Chou; Watanabe; Matulic-Adamic; Su; Fox; Polsky; Baron; Gold; Hardy; Zuckerman Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1640 - 1646 |
|
~%
Anhydro nucleoside CAS#:132776-19-3 |
| Literature: Huang; Chen; Wang; Kim; Warshaw; Armstrong; Zhu; Chou; Watanabe; Matulic-Adamic; Su; Fox; Polsky; Baron; Gold; Hardy; Zuckerman Journal of Medicinal Chemistry, 1991 , vol. 34, # 5 p. 1640 - 1646 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |