1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino)
Modify Date: 2026-07-10 21:22:02
![1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino) Structure](https://www.chemsrc.com/extcaspic/204/1328110-00-4.png)
1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino) structure
|
Common Name | 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino) | ||
|---|---|---|---|---|
| CAS Number | 1328110-00-4 | Molecular Weight | 241.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H27N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H27N3O |
|---|---|
| Molecular Weight | 241.37 |
| InChIKey | MWEIZTGBULWHSF-UHFFFAOYSA-N |
| SMILES | CCN(CC)C1CCN(C(=O)CCN(C)C)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino)? |
| A: InChIKey of 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino) is MWEIZTGBULWHSF-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino)? |
| A: Molecular weight of 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino) is 241.37. |
| Q: What is the CAS number of 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino)? |
| A: CAS number of 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino) is 1328110-00-4. |
| Q: What is the English name of 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino)? |
| A: The English name of 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino) is 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino). |
| Q: What is the Chinese name of 1328110-00-4? |
| A: Chinese name of 1328110-00-4 is 1328110-00-4. |
| Q: What is the molecular formula of 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino)? |
| A: Molecular formula of 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino) is C13H27N3O. |
| Q: What is the SMILES notation of 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino)? |
| A: SMILES notation of 1-Propanone, 1-[3-(diethylamino)-1-pyrrolidinyl]-3-(dimethylamino) is CCN(CC)C1CCN(C(=O)CCN(C)C)C1. |