Asarinin structure
|
Common Name | Asarinin | ||
|---|---|---|---|---|
| CAS Number | 133-05-1 | Molecular Weight | 354.353 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 504.4±50.0 °C at 760 mmHg | |
| Molecular Formula | C20H18O6 | Melting Point | 120-122ºC(lit.) | |
| MSDS | USA | Flash Point | 212.3±30.0 °C | |
| Name | 5,5'-(1R,3aR,4S,6aR)-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbi s(1,3-benzodioxole) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 504.4±50.0 °C at 760 mmHg |
| Melting Point | 120-122ºC(lit.) |
| Molecular Formula | C20H18O6 |
| Molecular Weight | 354.353 |
| Flash Point | 212.3±30.0 °C |
| Exact Mass | 354.110352 |
| PSA | 55.38000 |
| LogP | 3.32 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | PEYUIKBAABKQKQ-WZBLMQSHSA-N |
| SMILES | c1cc2c(cc1C1OCC3C(c4ccc5c(c4)OCO5)OCC13)OCO2 |
| Storage condition | -20°C |
| Safety Phrases | 24/25 |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 29329990 |
| 1,3-Benzodioxole, 5,5'-(tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl)bis- |
| 2,6-Bis(3,4-methylenedioxyphenyl)-3,7-dioxabicyclo[3.3.0]octane |
| 5,5'-(Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diyl)bis-1,3-benzodioxole |
| 5,5'-Tetrahydro-1H,3H-furo[3,4-c]furan-1,4-diylbis(1,3-benzodioxole) |
| 5-[4-(1,3-Benzodioxol-5-yl)tetrahydro-1H,3H-furo[3,4-c]furan-1-yl]-1,3-benzodioxole |
| 2,6-Bis(3,4-methylenedioxyphenyl)-3,7-dioxabicyclo(3.3.0)octane |
| 1,3-Benzodioxole, 5,5'-(tetrahydro-1H,3H-furo(3,4-c)furan-1,4-diyl)bis-, (+)- |
| Tetrahydro-1,4-bis[3,4-(methylenedioxy)phenyl]-1H,3H-furo[3,4-c]furan |