potassium 4-aminosalicylate structure
|
Common Name | potassium 4-aminosalicylate | ||
|---|---|---|---|---|
| CAS Number | 133-09-5 | Molecular Weight | 191.22600 | |
| Density | 1.491g/cm3 | Boiling Point | 380.8ºC at 760mmHg | |
| Molecular Formula | C7H6KNO3 | Melting Point | 150-151ºC, with effervescence | |
| MSDS | N/A | Flash Point | 184.1ºC | |
| Name | potassium,4-amino-2-hydroxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.491g/cm3 |
|---|---|
| Boiling Point | 380.8ºC at 760mmHg |
| Melting Point | 150-151ºC, with effervescence |
| Molecular Formula | C7H6KNO3 |
| Molecular Weight | 191.22600 |
| Flash Point | 184.1ºC |
| Exact Mass | 190.99800 |
| PSA | 86.38000 |
| Vapour Pressure | 1.78E-06mmHg at 25°C |
| InChIKey | PRZJIMSXCLZGLT-UHFFFAOYSA-M |
| SMILES | Nc1ccc(C(=O)[O-])c(O)c1.[K+] |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzoic acid,4-amino-2-hydroxy-,monopotassium salt |
| p-Aminosalicylate acid potassium salt |
| Monopotassium 4-aminosalicylate |
| PASKALIUM |
| Benzoic acid,4-amino-2-hydroxy-,potassium salt (1:1) |
| POTASSIUM AMINOSALICYLATE |
| 4-aminosalicylic acid potassium salt |
| Aminosalicylate Potassium |
| potassium 4-amino-2-hydroxybenzoate |
| EINECS 205-090-7 |
| Potassium 4-aminosalicylate |