13-Epijhanol structure
|
Common Name | 13-Epijhanol | ||
|---|---|---|---|---|
| CAS Number | 133005-15-9 | Molecular Weight | 306.48 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 378.9±15.0 °C at 760 mmHg | |
| Molecular Formula | C20H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.6±14.6 °C | |
Use of 13-Epijhanol13-Epijhanol (compound 5) is a diterpenoid compound isolated from Grindelia scorzonerifolia[1]. |
| Name | 13-Epijhanol |
|---|---|
| Synonym | More Synonyms |
| Description | 13-Epijhanol (compound 5) is a diterpenoid compound isolated from Grindelia scorzonerifolia[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 378.9±15.0 °C at 760 mmHg |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.48 |
| Flash Point | 141.6±14.6 °C |
| Exact Mass | 306.255890 |
| PSA | 29.46000 |
| LogP | 5.18 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | MONXCRDSDZQGGT-UPQMVPBKSA-N |
| SMILES | C=CC1(C)CCC2C(C)(CCC3C(C)(CO)CCCC32C)O1 |
| Hazard Codes | Xi |
|---|
| 1H-Naphtho[2,1-b]pyran-7-methanol, 3-ethenyldodecahydro-3,4a,7,10a-tetramethyl-, (3S,4aR,6aR,7R,10aS,10bR)- |
| [(3S,4aR,6aR,7R,10aS,10bR)-3,4a,7,10a-Tetramethyl-3-vinyldodecahydro-1H-benzo[f]chromen-7-yl]methanol |