[4-(Benzyloxy)-3-fluorophenyl]boronic acid structure
|
Common Name | [4-(Benzyloxy)-3-fluorophenyl]boronic acid | ||
|---|---|---|---|---|
| CAS Number | 133057-83-7 | Molecular Weight | 246.042 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 428.0±55.0 °C at 760 mmHg | |
| Molecular Formula | C13H12BFO3 | Melting Point | 116 °C | |
| MSDS | N/A | Flash Point | 212.6±31.5 °C | |
| Name | 4-(Benzyloxy)-3-fluorophenylboronic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 428.0±55.0 °C at 760 mmHg |
| Melting Point | 116 °C |
| Molecular Formula | C13H12BFO3 |
| Molecular Weight | 246.042 |
| Flash Point | 212.6±31.5 °C |
| Exact Mass | 246.086349 |
| PSA | 49.69000 |
| LogP | 3.16 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | DQPDLDQJMUGVGI-UHFFFAOYSA-N |
| SMILES | OB(O)c1ccc(OCc2ccccc2)c(F)c1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39-S37/39 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| MFCD00994627 |
| 4-Benzyloxy-3-fluorobenzeneboronic Acid |
| 4-Benzyloxy-3-fluorophenylboronic Acid |
| 4-(benzyloxy)-3-fluorophenylboronic acid |
| [4-(Benzyloxy)-3-fluorophenyl]boronic acid |
| Boronic acid, B-[3-fluoro-4-(phenylmethoxy)phenyl]- |
| (3-fluoro-4-phenylmethoxyphenyl)boronic acid |