(S)-3-Butene-1,2-diol-1-(p-toluenesulfonate) structure
|
Common Name | (S)-3-Butene-1,2-diol-1-(p-toluenesulfonate) | ||
|---|---|---|---|---|
| CAS Number | 133095-74-6 | Molecular Weight | 242.29100 | |
| Density | 1.234 g/cm3 | Boiling Point | 398.3ºC at 760 mmHg | |
| Molecular Formula | C11H14O4S | Melting Point | 58-63ºC | |
| MSDS | Chinese USA | Flash Point | 194.7ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (S)-2-Hydroxy-3-buten-1-yl p-tosylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.234 g/cm3 |
|---|---|
| Boiling Point | 398.3ºC at 760 mmHg |
| Melting Point | 58-63ºC |
| Molecular Formula | C11H14O4S |
| Molecular Weight | 242.29100 |
| Flash Point | 194.7ºC |
| Exact Mass | 242.06100 |
| PSA | 71.98000 |
| LogP | 2.32800 |
| Vapour Pressure | 4.65E-07mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | YQSCDBZHHLIPOI-JTQLQIEISA-N |
| SMILES | C=CC(O)COS(=O)(=O)c1ccc(C)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 26-36 |
| RIDADR | NONH for all modes of transport |
|
~85%
(S)-3-Butene-1,... CAS#:133095-74-6 |
| Literature: Jhillu Singh, Yadav; Rao Yarrapothu, Gangadhara; Vemula, Rajender RSC Advances, 2013 , vol. 3, # 1 p. 55 - 58 |
|
~%
(S)-3-Butene-1,... CAS#:133095-74-6
Detail
|
| Literature: European Journal of Organic Chemistry, , # 7 p. 1671 - 1678 |
|
~%
(S)-3-Butene-1,... CAS#:133095-74-6 |
| Literature: Tetrahedron Letters, , vol. 34, # 10 p. 1629 - 1630 |
|
~%
(S)-3-Butene-1,... CAS#:133095-74-6 |
| Literature: Tetrahedron Asymmetry, , vol. 5, # 2 p. 153 - 156 |
| (s)-1-tosyloxy-3-buten-1-ol |
| MFCD00145259 |