2,4(1H,3H)-Pyrimidinedione,6-propyl- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,6-propyl- | ||
|---|---|---|---|---|
| CAS Number | 13345-08-9 | Molecular Weight | 154.16600 | |
| Density | 1.126g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C7H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-propyl-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.126g/cm3 |
|---|---|
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.16600 |
| Exact Mass | 154.07400 |
| PSA | 65.72000 |
| LogP | 0.01570 |
| Index of Refraction | 1.481 |
| InChIKey | IMUTYIOWQFQGIC-UHFFFAOYSA-N |
| SMILES | CCCc1cc(=O)[nH]c(=O)[nH]1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933599090 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-propyl(1H,3H)pyrimidine-2,4-dione |
| 6-propylpyrimidine-2,4(1H,3H)-dione |
| 6-n-Propyluracil |
| 6-propyluracil |
| 6-Propyl-1H-pyrimidin-2,4-dion |