Propanedinitrile, 2-[[7-[5-[bis(4-Methylphenyl)amino]-2-thienyl]-2,1,3-benzothiadiazol-4-yl]Methylene]- structure
|
Common Name | Propanedinitrile, 2-[[7-[5-[bis(4-Methylphenyl)amino]-2-thienyl]-2,1,3-benzothiadiazol-4-yl]Methylene]- | ||
|---|---|---|---|---|
| CAS Number | 1335150-09-8 | Molecular Weight | 489.614 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 712.4±60.0 °C at 760 mmHg | |
| Molecular Formula | C28H19N5S2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 384.6±32.9 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | [(7-{5-[Bis(4-methylphenyl)amino]-2-thienyl}-2,1,3-benzothiadiazol-4-yl)methylene]malononitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 712.4±60.0 °C at 760 mmHg |
| Molecular Formula | C28H19N5S2 |
| Molecular Weight | 489.614 |
| Flash Point | 384.6±32.9 °C |
| Exact Mass | 489.108185 |
| LogP | 8.04 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.736 |
| InChIKey | BCJCBXQJAANTJL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(-c3ccc(C=C(C#N)C#N)c4nsnc34)s2)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |
|
A low-energy-gap organic dye for high-performance small-molecule organic solar cells.
J. Am. Chem. Soc. 133 , 15822-15825, (2011) A novel donor-acceptor-acceptor (D-A-A) donor molecule, DTDCTB, in which an electron-donating ditolylaminothienyl moiety and an electron-withdrawing dicyanovinylene moiety are bridged by another elect... |
| [(7-{5-[Bis(4-methylphenyl)amino]-2-thienyl}-2,1,3-benzothiadiazol-4-yl)methylene]malononitrile |
| MFCD25976535 |
| Propanedinitrile, 2-[[7-[5-[bis(4-methylphenyl)amino]-2-thienyl]-2,1,3-benzothiadiazol-4-yl]methylene]- |