(R)-(+)-2,2'-Bis(di-p-tolylphosphino)-6,6'-dimethoxy-1,1'-biphenyl,min.97 structure
|
Common Name | (R)-(+)-2,2'-Bis(di-p-tolylphosphino)-6,6'-dimethoxy-1,1'-biphenyl,min.97 | ||
|---|---|---|---|---|
| CAS Number | 133545-24-1 | Molecular Weight | 488.539 | |
| Density | N/A | Boiling Point | 608.1±55.0 °C at 760 mmHg | |
| Molecular Formula | C33H30P2 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 321.5±31.5 °C | |
| Name | (R)-(+)-2,2'-Bis(di-p-tolylphosphino)-6,6'-dimethoxy-1,1'-biphenyl |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 608.1±55.0 °C at 760 mmHg |
|---|---|
| Molecular Formula | C33H30P2 |
| Molecular Weight | 488.539 |
| Flash Point | 321.5±31.5 °C |
| Exact Mass | 488.182281 |
| Appearance of Characters | solid | white to pale yellow |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| InChIKey | DTMVLPFJTUJZAY-UHFFFAOYSA-N |
| SMILES | COc1cccc(P(c2ccc(C)cc2)c2ccc(C)cc2)c1-c1c(OC)cccc1P(c1ccc(C)cc1)c1ccc(C)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| Bis(4-methylphenyl){2'-[(4-methylphenyl)phosphino]-2-biphenylyl}phosphine |
| MFCD09753006 |
| Phosphine, bis(4-methylphenyl)[2'-[(4-methylphenyl)phosphino][1,1'-biphenyl]-2-yl]- |