Naphtho[1,2-c:5,6-c']bis([1,2,5]thiadiazole) structure
|
Common Name | Naphtho[1,2-c:5,6-c']bis([1,2,5]thiadiazole) | ||
|---|---|---|---|---|
| CAS Number | 133546-47-1 | Molecular Weight | 244.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H4N4S2 | Melting Point | 248 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | naphtho[1,2-c:5,6-c']bis[1,2,5]thiadiazole |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 248 °C |
|---|---|
| Molecular Formula | C10H4N4S2 |
| Molecular Weight | 244.29600 |
| Exact Mass | 243.98800 |
| PSA | 108.04000 |
| LogP | 2.84920 |
| InChIKey | VHHDKHOBNKXVNU-UHFFFAOYSA-N |
| SMILES | c1cc2c(ccc3nsnc32)c2nsnc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| RIDADR | NONH for all modes of transport |
|
Donor-acceptor conjugated polymer based on naphtho[1,2-c:5,6-c]bis[1,2,5]thiadiazole for high-performance polymer solar cells.
J. Am. Chem. Soc. 133(25) , 9638-9641, (2011) Donor-acceptor conjugated polymers PBDT-DTBT and PBDT-DTNT, based on 2,1,3-benzothiadiazole (BT) and naphtho[1,2-c:5,6-c]bis[1,2,5]thiadiazole (NT), have been designed and synthesized for polymer sola... |
| naphtho[1,2-c:5,6-c]bis[1,2,5]thiadiazole |
| naphtho[1,2-c:5,6-c']bis[1,2,5]thiadiazole |
| NAPHTHO[1,2-C:5,6-C']BIS[1,2,5]THIADIAZOLE |