.beta.-Cellobiose
.beta.-Cellobiose structure
|
Common Name | .beta.-Cellobiose | ||
|---|---|---|---|---|
| CAS Number | 13360-52-6 | Molecular Weight | 342.29600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Beta-cellobiose, Chinese name: .β.-Cellobiose, CAS number: 13360-52-6, molecular formula: C12H22O11, molecular weight: 342.29600. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | .β.-Cellobiose |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H22O11 |
|---|---|
| Molecular Weight | 342.29600 |
| Exact Mass | 342.11600 |
| PSA | 189.53000 |
| InChIKey | GUBGYTABKSRVRQ-UHFFFAOYSA-N |
| SMILES | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 10 | |
CAS#:35405-71-1
CAS#:79-14-1
CAS#:526-95-4
CAS#:110-15-6
CAS#:144-62-7
CAS#:64-19-7
CAS#:50-99-7
CAS#:2280-44-6
CAS#:64-18-6
CAS#:57-48-7This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Lactite |
| Lactnol |
| Lactitol anhydrous |
| 4-O-D-Galactopyranosyl-D-glucitol monohydrate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of .β.-Cellobiose? |
| A: Related downstream products(CAS) of .β.-Cellobiose: 35405-71-1;79-14-1;526-95-4;110-15-6;144-62-7;64-19-7;50-99-7;2280-44-6;64-18-6;57-48-7. |
| Q: What is the InChIKey of .β.-Cellobiose? |
| A: InChIKey of .β.-Cellobiose is GUBGYTABKSRVRQ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of .β.-Cellobiose? |
| A: SMILES notation of .β.-Cellobiose is C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O. |
| Q: What is the polar surface area (PSA) of .β.-Cellobiose? |
| A: Polar surface area (PSA) of .β.-Cellobiose is 189.53000. |
| Q: What English synonyms does .β.-Cellobiose have? |
| A: English synonyms of .β.-Cellobiose: Lactite, Lactnol, Lactitol anhydrous, 4-O-D-Galactopyranosyl-D-glucitol monohydrate. |
| Q: What is the molecular formula of .β.-Cellobiose? |
| A: Molecular formula of .β.-Cellobiose is C12H22O11. |
| Q: What is the Chinese name of 13360-52-6? |
| A: Chinese name of 13360-52-6 is 13360-52-6. |
| Q: What is the English name of .β.-Cellobiose? |
| A: The English name of .β.-Cellobiose is .β.-Cellobiose. |
| Q: What is the molecular weight of .β.-Cellobiose? |
| A: Molecular weight of .β.-Cellobiose is 342.29600. |
| Q: What is the CAS number of .β.-Cellobiose? |
| A: CAS number of .β.-Cellobiose is 13360-52-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |