Exoticin structure
|
Common Name | Exoticin | ||
|---|---|---|---|---|
| CAS Number | 13364-94-8 | Molecular Weight | 462.447 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 641.5±55.0 °C at 760 mmHg | |
| Molecular Formula | C23H26O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.9±31.5 °C | |
Use of ExoticinExoticin is a natural product that can be isolated from the leaves of Nicotiana plumbaginifolia[1]. |
| Name | 3,5,6,7,8-Pentamethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-on e |
|---|---|
| Synonym | More Synonyms |
| Description | Exoticin is a natural product that can be isolated from the leaves of Nicotiana plumbaginifolia[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 641.5±55.0 °C at 760 mmHg |
| Molecular Formula | C23H26O10 |
| Molecular Weight | 462.447 |
| Flash Point | 275.9±31.5 °C |
| Exact Mass | 462.152588 |
| PSA | 104.05000 |
| LogP | 1.35 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.571 |
| InChIKey | XOMNGQLSQXRGSF-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2oc3c(OC)c(OC)c(OC)c(OC)c3c(=O)c2OC)cc(OC)c1OC |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914509090 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,5,6,7,8-pentahydroxy-flavone |
| 4H-1-Benzopyran-4-one,3,5,6,7,8-pentahydroxy-2-phenyl |
| 3,5,6,7,8-Pentahydroxy-2-phenyl-chromen-4-on |
| 5,3'-Dimethyl-digicitrin |
| 4H-1-Benzopyran-4-one, 3,5,6,7,8-pentamethoxy-2-(3,4,5-trimethoxyphenyl)- |
| 3,5,6,7,8-pentahydroxy-2-phenyl-chromen-4-one |
| 3,5,6,7,8-Pentamethoxy-2-(3,4,5-trimethoxyphenyl)-4H-chromen-4-one |
| 3,5,6,7,8,3',4',5'-Octamethoxy-flavon |
| 3,3',4',5,5',6,7,8-octamethoxyflavone |
| 3,5,6,7,8-pentahydroxy-2-phenyl-4H-1-benzopyran-4-one |