D-Glucitol,1,4:3,6-dianhydro-2,5-bis-O-(2-oxiranylmethyl)- structure
|
Common Name | D-Glucitol,1,4:3,6-dianhydro-2,5-bis-O-(2-oxiranylmethyl)- | ||
|---|---|---|---|---|
| CAS Number | 13374-44-2 | Molecular Weight | 258.26800 | |
| Density | 1.33g/cm3 | Boiling Point | 422.1ºC at 760 mmHg | |
| Molecular Formula | C12H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.1ºC | |
| Name | D-Sorbitol, 1,4_3,6-dianhydro-2,5-bis-O-(2,3-epoxypropyl) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.33g/cm3 |
|---|---|
| Boiling Point | 422.1ºC at 760 mmHg |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.26800 |
| Flash Point | 183.1ºC |
| Exact Mass | 258.11000 |
| PSA | 61.98000 |
| Vapour Pressure | 6.06E-07mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | JEBWAOITKHXCBF-BEAPMJEYSA-N |
| SMILES | C1OC1COC1COC2C(OCC3CO3)COC12 |
| HS Code | 2932999099 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| isosorbide bisglycidyl ether |
| diglycidyl dianhydrohexanehexol |
| isosorbide diglycidyl ether |
| isosorbide 2,5-di-glycidyl ether |