1-(2,4,6-trihydroxy-3,5-dimethylphenyl)ethan-1-one structure
|
Common Name | 1-(2,4,6-trihydroxy-3,5-dimethylphenyl)ethan-1-one | ||
|---|---|---|---|---|
| CAS Number | 13383-63-6 | Molecular Weight | 196.20000 | |
| Density | 1.318g/cm3 | Boiling Point | 355.5ºC at 760mmHg | |
| Molecular Formula | C10H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183ºC | |
| Name | 1-(2,4,6-trihydroxy-3,5-dimethylphenyl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.318g/cm3 |
|---|---|
| Boiling Point | 355.5ºC at 760mmHg |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20000 |
| Flash Point | 183ºC |
| Exact Mass | 196.07400 |
| PSA | 77.76000 |
| LogP | 1.62280 |
| Vapour Pressure | 1.52E-05mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | GIMGGNBXMNVHHR-UHFFFAOYSA-N |
| SMILES | CC(=O)c1c(O)c(C)c(O)c(C)c1O |
| HS Code | 2914400090 |
|---|
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1-(2,4,6-trihydroxy-3,5-dimethyl-phenyl)-ethanone |
| Phloroacetophenone,3',5'-dimethyl-(6CI) |
| 3,5-Dimethyl-phloroacetophenon |
| Ethanone,1-(2,4,6-trihydroxy-3,5-dimethylphenyl) |
| EINECS 236-459-0 |
| 1-(2,4,6-Trihydroxy-3,5-dimethylphenyl)ethan-1-one |
| Acetophenone,2',4',6'-trihydroxy-3',5'-dimethyl-(7CI,8CI) |
| 1-(2,4,6-Trihydroxy-3,5-dimethyl-phenyl)-aethanon |
| 2,4,6-trihydroxy-3,5-dimethylacetophenone |
| Dimethylphloroacetophenon |