7-Methoxyindazole-3-carboxylic acid structure
|
Common Name | 7-Methoxyindazole-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 133841-08-4 | Molecular Weight | 192.171 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 467.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C9H8N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.6±23.2 °C | |
| Name | 7-methoxy-1H-indazole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 467.6±25.0 °C at 760 mmHg |
| Molecular Formula | C9H8N2O3 |
| Molecular Weight | 192.171 |
| Flash Point | 236.6±23.2 °C |
| Exact Mass | 192.053497 |
| PSA | 75.21000 |
| LogP | 1.21 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.689 |
| InChIKey | DSUBKQPNJIQYOT-UHFFFAOYSA-N |
| SMILES | COc1cccc2c(C(=O)O)n[nH]c12 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole-3-carboxylicacid,7-methoxy |
| 7-Methoxyindazole-3-carboxylic acid |
| 1H-Indazole-3-carboxylic acid, 7-methoxy- |
| 7-Methoxy-1H-indazole-3-carboxylic acid |