2-Chloro-N4-(2-methypropyl)-3,4-quinolinediamine structure
|
Common Name | 2-Chloro-N4-(2-methypropyl)-3,4-quinolinediamine | ||
|---|---|---|---|---|
| CAS Number | 133860-76-1 | Molecular Weight | 249.73900 | |
| Density | 1.246g/cm3 | Boiling Point | 395.724ºC at 760 mmHg | |
| Molecular Formula | C13H16ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 193.127ºC | |
| Name | 2-Chloro-N4-isobutylquinoline-3,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 395.724ºC at 760 mmHg |
| Molecular Formula | C13H16ClN3 |
| Molecular Weight | 249.73900 |
| Flash Point | 193.127ºC |
| Exact Mass | 249.10300 |
| PSA | 50.94000 |
| LogP | 4.19250 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.669 |
| InChIKey | JARNINMUMFRNPS-UHFFFAOYSA-N |
| SMILES | CC(C)CNc1c(N)c(Cl)nc2ccccc12 |
| HS Code | 2933499090 |
|---|
|
~73%
2-Chloro-N4-(2-... CAS#:133860-76-1 |
| Literature: US4988815 A1, ; |
|
~%
2-Chloro-N4-(2-... CAS#:133860-76-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 48, # 10 p. 3481 - 3491 |
|
~%
2-Chloro-N4-(2-... CAS#:133860-76-1 |
| Literature: Journal of Medicinal Chemistry, , vol. 48, # 10 p. 3481 - 3491 |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD07780284 |
| 2-chloro-4-N-(2-methylpropyl)quinoline-3,4-diamine |