2,4-DICHLORO-3-NITRO-QUINOLINE structure
|
Common Name | 2,4-DICHLORO-3-NITRO-QUINOLINE | ||
|---|---|---|---|---|
| CAS Number | 132521-66-5 | Molecular Weight | 243.04600 | |
| Density | 1.593g/cm3 | Boiling Point | 359.7ºC at 760 mmHg | |
| Molecular Formula | C9H4Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.3ºC | |
| Name | 2,4-Dichloro-3-nitroquinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.593g/cm3 |
|---|---|
| Boiling Point | 359.7ºC at 760 mmHg |
| Molecular Formula | C9H4Cl2N2O2 |
| Molecular Weight | 243.04600 |
| Flash Point | 171.3ºC |
| Exact Mass | 241.96500 |
| PSA | 58.71000 |
| LogP | 3.97300 |
| Vapour Pressure | 4.84E-05mmHg at 25°C |
| Index of Refraction | 1.693 |
| InChIKey | RSFJVCHKGRUCIC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(Cl)nc2ccccc2c1Cl |
| HS Code | 2933499090 |
|---|
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Quinoline,2,4-dichloro-3-nitro |
| 2,4-Dichlor-3-nitro-chinolin |
| 2,4-dichloro-3-nitro-quinoline |
| 2,4-chloro-3-nitroquinoline |
| QUI137 |