5-Methyltetrahydrofolate
Modify Date: 2025-08-23 11:46:40
5-Methyltetrahydrofolate structure
|
Common Name | 5-Methyltetrahydrofolate | ||
|---|---|---|---|---|
| CAS Number | 134-35-0 | Molecular Weight | 459.46 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H25N7O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5-Methyltetrahydrofolate5-Methyltetrahydrofolic acid is a biologically active form of folic acid. 5-Methyltetrahydrofolic acid is a methylated derivate of tetrahydrofolate. 5-Methyltetrahydrofolic acid is the predominant natural dietary folate and the principal form of folate in plasma and cerebrospinal fluid[1]. |
| Name | 5-methyltetrahydrofolic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Methyltetrahydrofolic acid is a biologically active form of folic acid. 5-Methyltetrahydrofolic acid is a methylated derivate of tetrahydrofolate. 5-Methyltetrahydrofolic acid is the predominant natural dietary folate and the principal form of folate in plasma and cerebrospinal fluid[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Molecular Formula | C20H25N7O6 |
| Molecular Weight | 459.46 |
| Exact Mass | 459.186646 |
| PSA | 180.77000 |
| LogP | -2.61 |
| Index of Refraction | 1.733 |
| InChIKey | ZNOVTXRBGFNYRX-ABLWVSNPSA-N |
| SMILES | CN1c2c(nc(N)[nH]c2=O)NCC1CNc1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1 |
| Storage condition | 2-8℃ |
|
Name: Determination of IC50 values for inhibition of SARS-CoV-2 induced cytotoxicity of VER...
Source: ChEMBL
Target: Severe acute respiratory syndrome coronavirus 2
External Id: CHEMBL4651404
|
|
Name: Inhibition of Escherichia coli K-12 recombinant His-tagged folylpoly-gamma-glutamate ...
Source: ChEMBL
Target: Dihydrofolate synthase/folylpolyglutamate synthase
External Id: CHEMBL1227290
|
Total 2, Current Page 1 of 1
1
| MethylFolate |
| 5-Methyltetrahydropteroylglutamate |
| 5-methyl-tetrahydrofolate |
| N5-Methyl-tetrahydrofolic acid |
| N-(5-methyl-5,6,7,8-tetrahydro-pteroyl)-glutamic acid |
| 5-Methyltetrahydrofolate |
| (+-)-L-5-Methyl-5,6,7,8-tetrahydrofolsaeure |
| N-(4-{[(2-Amino-5-methyl-4-oxo-1,4,5,6,7,8-hexahydro-6-pteridinyl)methyl]amino}benzoyl)-D-glutamic acid |
| n5-methyltetrahydrofolate |
| methyl-THF |
| N5-methyl-THF |
| 5-methyl-(6S)-tetrahydrofolic acid |
| 5-methyl-5,6,7,8-tetrahydrofolate |
| 5-METHYL-THF |
| METHYLTETRAHYDROFOLICACID |
| methyl-H4F |
| n5-CH3-THF |
| N5-Methyl-tetrahydrofolate |
| N-Methyltetrahydrofolic acid |