1,3-Dibromo-2-nitrobenzene structure
|
Common Name | 1,3-Dibromo-2-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 13402-32-9 | Molecular Weight | 280.901 | |
| Density | 2.1±0.1 g/cm3 | Boiling Point | 243.0±20.0 °C at 760 mmHg | |
| Molecular Formula | C6H3Br2NO2 | Melting Point | 84 °C | |
| MSDS | N/A | Flash Point | 100.7±21.8 °C | |
| Name | 1,3-dibromo-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 2.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 243.0±20.0 °C at 760 mmHg |
| Melting Point | 84 °C |
| Molecular Formula | C6H3Br2NO2 |
| Molecular Weight | 280.901 |
| Flash Point | 100.7±21.8 °C |
| Exact Mass | 278.853027 |
| PSA | 45.82000 |
| LogP | 3.05 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.640 |
| InChIKey | HATHNBZPXBWLFB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1c(Br)cccc1Br |
| Hazard Codes | Xn |
|---|---|
| HS Code | 2904909090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,3-Dibrom-2-nitro-benzol |
| 1,3-Dibromo-2-nitrobenzene |
| 2,6-dibromobenzene |
| 1,3-dibromo-2-nitro-benzene |
| 2,6-DIBROMONITROBENZENE |
| 1,3-Dibromo-2-nitro-benzen |