2,4-Di(tert-pentyl)phenoxyacetic acid structure
|
Common Name | 2,4-Di(tert-pentyl)phenoxyacetic acid | ||
|---|---|---|---|---|
| CAS Number | 13402-96-5 | Molecular Weight | 292.41300 | |
| Density | 1.004g/cm3 | Boiling Point | 391.1ºC at 760mmHg | |
| Molecular Formula | C18H28O3 | Melting Point | 125-127 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,4-Di(tert-amyl)phenoxyacetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.004g/cm3 |
|---|---|
| Boiling Point | 391.1ºC at 760mmHg |
| Melting Point | 125-127 °C(lit.) |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.41300 |
| Exact Mass | 292.20400 |
| PSA | 46.53000 |
| LogP | 4.52520 |
| Vapour Pressure | 8.09E-07mmHg at 25°C |
| InChIKey | QXQMENSTZKYZCE-UHFFFAOYSA-N |
| SMILES | CCC(C)(C)c1ccc(OCC(=O)O)c(C(C)(C)CC)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918990090 |
|
~%
2,4-Di(tert-pen... CAS#:13402-96-5 |
| Literature: US2511231 , ; US2772162 , ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[2,4-bis(2-methylbutan-2-yl)phenoxy]acetic acid |
| EINECS 236-494-1 |
| MFCD00128799 |
| 2,4-Di(tert-pentyl)phenoxyacetic acid |
| 2-(2,4-Di-tert-pentylphenoxy)acetic acid |