(1S)-(-)-Camphanic acid structure
|
Common Name | (1S)-(-)-Camphanic acid | ||
|---|---|---|---|---|
| CAS Number | 13429-83-9 | Molecular Weight | 198.216 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 355.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H14O4 | Melting Point | 201-205 °C | |
| MSDS | Chinese USA | Flash Point | 142.1±16.7 °C | |
| Name | (1S)-(-)-Camphanic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 355.5±25.0 °C at 760 mmHg |
| Melting Point | 201-205 °C |
| Molecular Formula | C10H14O4 |
| Molecular Weight | 198.216 |
| Flash Point | 142.1±16.7 °C |
| Exact Mass | 198.089203 |
| PSA | 63.60000 |
| LogP | 0.52 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.532 |
| InChIKey | KPWKPGFLZGMMFX-UHFFFAOYSA-N |
| SMILES | CC12CCC(C(=O)O)(OC1=O)C2(C)C |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S22-S24/25-S37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29329995 |
| HS Code | 2916209090 |
|---|---|
| Summary | 2916209090 other cyclanic, cyclenic or cyclotherpenic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| (1S)-4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid |
| (1R)-(-)-CAMPHANIC ACID |
| (S)-(-)-1-CAMPHANIC ACID |
| 2-Oxabicyclo[2.2.1]heptane-1-carboxylic acid, 4,7,7-trimethyl-3-oxo- |
| (-)-1(1S,4R)-camphanic acid |
| (-)-CaMphanic Acid |
| (1S,4R)-4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid |
| 4,7,7-Trimethyl-3-oxo-2-oxabicyclo[2.2.1]heptane-1-carboxylic acid |
| (IS) CAMPHANIC ACID |
| (-) Camphenic acid |
| MFCD00044948 |
| (S)-(-)-camphanoyl chloride |
| (1S)-(-)-Camphanic acid |
| EINECS 236-552-6 |