methyl 2-[(2-phenylmethoxycarbonylaminoacetyl)amino]acetate structure
|
Common Name | methyl 2-[(2-phenylmethoxycarbonylaminoacetyl)amino]acetate | ||
|---|---|---|---|---|
| CAS Number | 13437-63-3 | Molecular Weight | 280.27700 | |
| Density | 1.237g/cm3 | Boiling Point | 494.6ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253ºC | |
| Name | methyl 2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetate |
|---|
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 494.6ºC at 760 mmHg |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.27700 |
| Flash Point | 253ºC |
| Exact Mass | 280.10600 |
| PSA | 93.73000 |
| LogP | 0.98380 |
| Vapour Pressure | 6.33E-10mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | TXMIOBGEEHTBRF-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)CNC(=O)OCc1ccccc1 |
| HS Code | 2924299090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |