Z-Gly-Gly-Ala-OH structure
|
Common Name | Z-Gly-Gly-Ala-OH | ||
|---|---|---|---|---|
| CAS Number | 19912-36-8 | Molecular Weight | 337.32800 | |
| Density | 1.312 g/cm3 | Boiling Point | 720.2ºC at 760 mmHg | |
| Molecular Formula | C15H19N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 389.4ºC | |
| Name | 2-[[2-[[2-(phenylmethoxycarbonylamino)acetyl]amino]acetyl]amino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.312 g/cm3 |
|---|---|
| Boiling Point | 720.2ºC at 760 mmHg |
| Molecular Formula | C15H19N3O6 |
| Molecular Weight | 337.32800 |
| Flash Point | 389.4ºC |
| Exact Mass | 337.12700 |
| PSA | 133.83000 |
| LogP | 0.79100 |
| Vapour Pressure | 9.06E-22mmHg at 25°C |
| Index of Refraction | 1.554 |
| InChIKey | BGGKRFZYJZIAOK-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)CNC(=O)CNC(=O)OCc1ccccc1)C(=O)O |
|
~%
Z-Gly-Gly-Ala-OH CAS#:19912-36-8 |
| Literature: Levy; Palmer Journal of Biological Chemistry, 1943 , vol. 150, p. 271,277 |
|
~%
Z-Gly-Gly-Ala-OH CAS#:19912-36-8 |
| Literature: Levy; Palmer Journal of Biological Chemistry, 1943 , vol. 150, p. 271,277 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Z-Gly-Gly-Ala |