2,4-Bis[4-(N,N-diphenylamino)-2,6-dihydroxyphenyl]squaraine structure
|
Common Name | 2,4-Bis[4-(N,N-diphenylamino)-2,6-dihydroxyphenyl]squaraine | ||
|---|---|---|---|---|
| CAS Number | 1345272-10-7 | Molecular Weight | 634.676 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H30N2O6 | Melting Point | 328-333 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,4-Bis[4-(N,N-diphenylamino)-2,6-dihydroxyphenyl]squaraine |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 328-333 °C |
|---|---|
| Molecular Formula | C40H30N2O6 |
| Molecular Weight | 634.676 |
| Exact Mass | 634.210388 |
| InChIKey | IHYPRNCXUQJOKD-UHFFFAOYSA-N |
| SMILES | O=C1C(=C2C(O)=CC(=[N+](c3ccccc3)c3ccccc3)C=C2O)C([O-])=C1c1c(O)cc(N(c2ccccc2)c2ccccc2)cc1O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
|
Functionalized squaraine donors for nanocrystalline organic photovoltaics.
ACS Nano 6 , 972-978, (2012) We study a family of functionalized squaraine (fSQ) donors for absorbing in the near-infrared (NIR) and green spectral regions. The NIR-absorbing materials are the symmetric molecules 2,4-bis[4-(N-phe... |
|
|
High efficiency organic photovoltaic cells based on a vapor deposited squaraine donor Wang, S.; Mayo, E.; Perez M.; et al.
Appl. Phys. Lett. 94 , 233304, (2009)
|
| 2,4-Bis[4-(diphenylamino)-2,6-dihydroxyphenyl]cyclobutane-1,3-bis(ylium)-1,3-diolate |
| Cyclobutane-1,3-diylium, 2,4-bis[4-(diphenylamino)-2,6-dihydroxyphenyl]-1,3-dihydroxy-, ion(2-) |