3,5,5-trimethylhexyl 2-methylprop-2-enoate structure
|
Common Name | 3,5,5-trimethylhexyl 2-methylprop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 13453-03-7 | Molecular Weight | 212.32800 | |
| Density | 0.877g/cm3 | Boiling Point | 256.3ºC at 760 mmHg | |
| Molecular Formula | C13H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96.6ºC | |
| Name | 3,5,5-trimethylhexyl 2-methylprop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.877g/cm3 |
|---|---|
| Boiling Point | 256.3ºC at 760 mmHg |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.32800 |
| Flash Point | 96.6ºC |
| Exact Mass | 212.17800 |
| PSA | 26.30000 |
| LogP | 3.56810 |
| Vapour Pressure | 0.0156mmHg at 25°C |
| Index of Refraction | 1.438 |
| InChIKey | BBPSWYWJFWHIHC-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OCCC(C)CC(C)(C)C |
| HS Code | 2916140000 |
|---|
| HS Code | 2916140000 |
|---|---|
| Summary | 2916140000. other esters of methacrylic acid. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:80.0% |
| EINECS 236-621-0 |
| 3,5,5-trimethylhexyl methacrylate |