3,5,5-trimethylhexyl 2-ethylhexanoate structure
|
Common Name | 3,5,5-trimethylhexyl 2-ethylhexanoate | ||
|---|---|---|---|---|
| CAS Number | 85118-40-7 | Molecular Weight | 270.45100 | |
| Density | 0.862g/cm3 | Boiling Point | 286.8ºC at 760 mmHg | |
| Molecular Formula | C17H34O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134ºC | |
| Name | 3,5,5-trimethylhexyl 2-ethylhexanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.862g/cm3 |
|---|---|
| Boiling Point | 286.8ºC at 760 mmHg |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.45100 |
| Flash Point | 134ºC |
| Exact Mass | 270.25600 |
| PSA | 26.30000 |
| LogP | 5.20840 |
| Index of Refraction | 1.439 |
| InChIKey | UVKYEIOCJVCWNW-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)OCCC(C)CC(C)(C)C |
| HS Code | 2915900090 |
|---|
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |
| einecs 285-695-0 |