4'-Chloro-3,4-dihydroxybenzophenone structure
|
Common Name | 4'-Chloro-3,4-dihydroxybenzophenone | ||
|---|---|---|---|---|
| CAS Number | 134612-84-3 | Molecular Weight | 248.66200 | |
| Density | 1.41g/cm3 | Boiling Point | 468.771ºC at 760 mmHg | |
| Molecular Formula | C13H9ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 237.304ºC | |
| Name | (4-chlorophenyl)-(3,4-dihydroxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.41g/cm3 |
|---|---|
| Boiling Point | 468.771ºC at 760 mmHg |
| Molecular Formula | C13H9ClO3 |
| Molecular Weight | 248.66200 |
| Flash Point | 237.304ºC |
| Exact Mass | 248.02400 |
| PSA | 57.53000 |
| LogP | 2.98220 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.655 |
| InChIKey | SYNNFRPIIUNOHK-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(Cl)cc1)c1ccc(O)c(O)c1 |
| HS Code | 2914700090 |
|---|
|
~%
4'-Chloro-3,4-d... CAS#:134612-84-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 20, # 14 p. 4132 - 4134 |
|
~%
4'-Chloro-3,4-d... CAS#:134612-84-3 |
| Literature: US5236952 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 4'-CHLORO-3,4-DIHYDROXYBENZOPHENONE |
| 4-chloro-3',4'-dihydroxydiphenylmethanone |