4-Chloro 3,4'-dimethoxy benzophenone
Modify Date: 2024-01-08 12:03:44
4-Chloro 3,4'-dimethoxy benzophenone structure
|
Common Name | 4-Chloro 3,4'-dimethoxy benzophenone | ||
|---|---|---|---|---|
| CAS Number | 116412-83-0 | Molecular Weight | 276.71500 | |
| Density | 1.216g/cm3 | Boiling Point | 414.5ºC at 760mmHg | |
| Molecular Formula | C15H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 167.2ºC | |
| Name | (4-chlorophenyl)-(3,4-dimethoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.216g/cm3 |
|---|---|
| Boiling Point | 414.5ºC at 760mmHg |
| Molecular Formula | C15H13ClO3 |
| Molecular Weight | 276.71500 |
| Flash Point | 167.2ºC |
| Exact Mass | 276.05500 |
| PSA | 35.53000 |
| LogP | 3.58820 |
| Vapour Pressure | 4.44E-07mmHg at 25°C |
| Index of Refraction | 1.566 |
| InChIKey | MLLIIHAKTPXMFF-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccc(Cl)cc2)cc1OC |
| Hazard Codes | N: Dangerous for the environment; |
|---|---|
| Risk Phrases | R50/53 |
| Safety Phrases | 60-61 |
| HS Code | 2914700090 |
|
~83%
4-Chloro 3,4'-d... CAS#:116412-83-0 |
| Literature: BASF Corporation Patent: US2001/31753 A1, 2001 ; |
|
~81%
4-Chloro 3,4'-d... CAS#:116412-83-0 |
| Literature: BASF Corporation Patent: US2001/31753 A1, 2001 ; |
|
~54%
4-Chloro 3,4'-d... CAS#:116412-83-0 |
| Literature: Lukacs, Gyula; Porcs-Makkay, Marta; Simig, Gyula European Journal of Organic Chemistry, 2004 , # 20 p. 4130 - 4140 |
CAS#:134612-84-3| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 3,4-dimethoxy-4'-chlorobenzophenone |
| (4-Chlorophenyl)(3,4-dimethoxyphenyl)methanone |
| 4-chloro-3',4'-dimethoxydiphenylmethanone |
| 4-Chloro-3',4'-dimethoxybenzophenone |
| Methanone,(4-chlorophenyl)(3,4-dimethoxyphenyl) |