barium(2+),phosphonato phosphate structure
|
Common Name | barium(2+),phosphonato phosphate | ||
|---|---|---|---|---|
| CAS Number | 13466-21-2 | Molecular Weight | 448.59700 | |
| Density | N/A | Boiling Point | 158ºC at 760mmHg | |
| Molecular Formula | Ba2O7P2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | barium(2+),phosphonato phosphate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 158ºC at 760mmHg |
|---|---|
| Molecular Formula | Ba2O7P2 |
| Molecular Weight | 448.59700 |
| Exact Mass | 449.72200 |
| PSA | 155.23000 |
| LogP | 0.94120 |
| InChIKey | RCUAPGYXYWSYKO-UHFFFAOYSA-J |
| SMILES | O=P([O-])([O-])OP(=O)([O-])[O-].[Ba+2].[Ba+2] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 + H332 |
| RIDADR | UN 1564 6.1 / PGIII |
|
Broadband NIR photoluminescence from Bi-doped Ba2P2O7 crystals: insights into the nature of NIR-emitting Bismuth centers.
Opt. Express 12th ed., 18 , 12852, (2010) We report on a novel type of Bi-doped crystal that exhibits ultrabroadband photoluminescence in the near infrared (NIR). Emission centers can be generated and degenerated reversibly by annealing the m... |
| Dibarium diphosphate |
| EINECS 236-716-7 |
| dibarium(2+) diphosphate |
| BARIUM PHOSPHATE (PYRO) |
| Barium pyrophosphate |