(R)-Azelastine N-Oxide (Mixture of Diastereomers) structure
|
Common Name | (R)-Azelastine N-Oxide (Mixture of Diastereomers) | ||
|---|---|---|---|---|
| CAS Number | 1346617-18-2 | Molecular Weight | 397.898 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H24ClN3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (R)-Azelastine N-Oxide (Mixture of Diastereomers) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H24ClN3O2 |
|---|---|
| Molecular Weight | 397.898 |
| Exact Mass | 397.155701 |
| LogP | 2.11 |
| InChIKey | QFWLGALGCDUDAP-QOBPCVTDSA-N |
| SMILES | C[N+]1([O-])CCCC(n2nc(Cc3ccc(Cl)cc3)c3ccccc3c2=O)CC1 |
| 4-(4-Chlorobenzyl)-2-[(4R)-1-methyl-1-oxido-4-azepanyl]-1(2H)-phthalazinone |
| 1(2H)-Phthalazinone, 4-[(4-chlorophenyl)methyl]-2-[(4R)-hexahydro-1-methyl-1-oxido-1H-azepin-4-yl]- |