2-[(6-bromo-4-oxo-3,1-benzoxazin-2-yl)methyl]isoindole-1,3-dione structure
|
Common Name | 2-[(6-bromo-4-oxo-3,1-benzoxazin-2-yl)methyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 134700-30-4 | Molecular Weight | 385.16800 | |
| Density | 1.76g/cm3 | Boiling Point | 557.7ºC at 760 mmHg | |
| Molecular Formula | C17H9BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.1ºC | |
| Name | 2-[(6-bromo-4-oxo-3,1-benzoxazin-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.76g/cm3 |
|---|---|
| Boiling Point | 557.7ºC at 760 mmHg |
| Molecular Formula | C17H9BrN2O4 |
| Molecular Weight | 385.16800 |
| Flash Point | 291.1ºC |
| Exact Mass | 383.97500 |
| PSA | 80.48000 |
| LogP | 2.68460 |
| Vapour Pressure | 1.79E-12mmHg at 25°C |
| Index of Refraction | 1.751 |
| InChIKey | UMFSKWFWODNSME-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1nc2ccc(Br)cc2c(=O)o1 |
|
~60%
2-[(6-bromo-4-o... CAS#:134700-30-4 |
| Literature: Journal of the Indian Chemical Society, , vol. 67, # 10 p. 852 - 854 |
| 2-((6-Bromo-4-oxo-4H-3,1-benzoxazin-2-yl)methyl)-1H-isoindole-1,3(2H)-dione |
| 1H-Isoindole-1,3(2H)-dione,2-((6-bromo-4-oxo-4H-3,1-benzoxazin-2-yl)methyl) |