phthalimidoacetyl chloride structure
|
Common Name | phthalimidoacetyl chloride | ||
|---|---|---|---|---|
| CAS Number | 6780-38-7 | Molecular Weight | 223.613 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 343.2±25.0 °C at 760 mmHg | |
| Molecular Formula | C10H6ClNO3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 161.4±23.2 °C | |
| Symbol |
GHS05, GHS06 |
Signal Word | Danger | |
| Name | (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)-acetyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 343.2±25.0 °C at 760 mmHg |
| Molecular Formula | C10H6ClNO3 |
| Molecular Weight | 223.613 |
| Flash Point | 161.4±23.2 °C |
| Exact Mass | 223.003616 |
| PSA | 54.45000 |
| LogP | 1.94 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | RHZBRCQIKQUQHQ-UHFFFAOYSA-N |
| SMILES | O=C(Cl)CN1C(=O)c2ccccc2C1=O |
| Storage condition | 2~8℃ |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | T:Toxic; |
| Risk Phrases | R25;R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | UN 2923 |
| WGK Germany | 3 |
| HS Code | 2925190090 |
|
~99%
phthalimidoacet... CAS#:6780-38-7 |
| Literature: Gustavsson, Anna-Lena; Tuvesson, Malena; Larsson, Mattias C.; Wenqi, Wu; Hansson, Bill S.; Liljefors, Tommy Journal of Chemical Ecology, 1997 , vol. 23, # 12 p. 2755 - 2776 |
|
~%
phthalimidoacet... CAS#:6780-38-7 |
| Literature: US5475106 A1, ; |
|
~%
phthalimidoacet... CAS#:6780-38-7 |
| Literature: Chemische Berichte, , vol. 123, # 8 p. 1691 - 1698 |
|
~%
phthalimidoacet... CAS#:6780-38-7 |
| Literature: Chemical and Pharmaceutical Bulletin, , vol. 40, # 12 p. 3174 - 3180 |
|
~%
phthalimidoacet... CAS#:6780-38-7 |
| Literature: Chemische Berichte, , vol. 40, p. 2648 Chemische Berichte, , vol. 41, p. 246 |
| Precursor 6 | |
|---|---|
| DownStream 10 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| phthalimidoacetyl chloride |
| Phthalylglycyl chloride |
| (1,3-Dioxo-1,3-dihydro-2H-isoindol-2-yl)acetyl chloride |
| MFCD00192872 |
| EINECS 229-840-8 |