2-Phthalimidehydroxy-acetic acid structure
|
Common Name | 2-Phthalimidehydroxy-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 134724-87-1 | Molecular Weight | 221.16600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2-Phthalimidehydroxy-acetic acid2-Phthalimidehydroxy-acetic acid is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-(1,3-dioxoisoindol-2-yl)oxyacetic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 2-Phthalimidehydroxy-acetic acid is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C10H7NO5 |
|---|---|
| Molecular Weight | 221.16600 |
| Exact Mass | 221.03200 |
| PSA | 83.91000 |
| LogP | 0.23670 |
| InChIKey | STDDDVARCIVORC-UHFFFAOYSA-N |
| SMILES | O=C(O)CON1C(=O)c2ccccc2C1=O |
|
~99%
2-Phthalimidehy... CAS#:134724-87-1 |
| Literature: Organic and Biomolecular Chemistry, , vol. 6, # 17 p. 3065 - 3078 |
|
~70%
2-Phthalimidehy... CAS#:134724-87-1 |
| Literature: Journal of the American Chemical Society, , vol. 133, # 19 p. 7469 - 7475 |
|
~%
2-Phthalimidehy... CAS#:134724-87-1 |
| Literature: US2012/322978 A1, ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-(Phth)-AOGly-OH |
| phthalmidooxyacetic acid |
| PhthN-O-Gly-OH |
| 2-((1,3-dioxoisoindolin-2-yl)oxy)acetic acid |
| phthalimidooxyacetic acid |
| phthalimido-aminooxyacetic acid |
| Pht-Aoaa-OH |
| Acetic acid,[(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)oxy] |