(+)-Clopidogrel bisulfate structure
|
Common Name | (+)-Clopidogrel bisulfate | ||
|---|---|---|---|---|
| CAS Number | 135046-48-9 | Molecular Weight | 419.900 | |
| Density | N/A | Boiling Point | 423.7ºC at 760 mmHg | |
| Molecular Formula | C16H18ClNO6S2 | Melting Point | 184ºC | |
| MSDS | USA | Flash Point | 210ºC | |
Use of (+)-Clopidogrel bisulfateClopidogrel sulfate is an antiplatelet agent. Specifically, Clopidogrel sulfate inhibits the binding of ADP to its receptors on the membranes of platelet cells, and blocks ADP-mediated activation of the glycoprotein GPIIb/IIIa complex. Clopidogrel sulfate can be used for research of heart disease and stroke[1]. |
| Name | (S)-Methyl 2-(2-chlorophenyl)-2-(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate |
|---|---|
| Synonym | More Synonyms |
| Description | Clopidogrel sulfate is an antiplatelet agent. Specifically, Clopidogrel sulfate inhibits the binding of ADP to its receptors on the membranes of platelet cells, and blocks ADP-mediated activation of the glycoprotein GPIIb/IIIa complex. Clopidogrel sulfate can be used for research of heart disease and stroke[1]. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 423.7ºC at 760 mmHg |
|---|---|
| Melting Point | 184ºC |
| Molecular Formula | C16H18ClNO6S2 |
| Molecular Weight | 419.900 |
| Flash Point | 210ºC |
| Exact Mass | 419.026398 |
| PSA | 140.76000 |
| LogP | 4.03980 |
| Vapour Pressure | 8.71E-09mmHg at 25°C |
| InChIKey | FDEODCTUSIWGLK-UHFFFAOYSA-N |
| SMILES | COC(=O)C(c1ccccc1Cl)N1CCc2sccc2C1.O=S(=O)(O)O |
| Storage condition | 2-8°C |
|
~91%
(+)-Clopidogrel... CAS#:135046-48-9 |
| Literature: RICHTER GEDEON NYRT. Patent: WO2009/77797 A1, 2009 ; Location in patent: Page/Page column 13 ; |
|
~84%
(+)-Clopidogrel... CAS#:135046-48-9 |
| Literature: IPCA Laboratories Limited Patent: EP1772455 A2, 2007 ; Location in patent: Page/Page column 10 ; |
|
~%
(+)-Clopidogrel... CAS#:135046-48-9 |
| Literature: US2004/24011 A1, ; Page 7 ; |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00876395 |
| Plavix |
| Clopidogrel Hydrogen sulfate |
| Methyl (2S)-(2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate |
| methyl (2S)-(2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)ethanoate sulfate |
| methyl (2S)-(2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)ethanoate sulfate (1:1) |
| Clopidogrel bisulfate |
| (2S)-(2-chlorophényl)(6,7-dihydrothiéno[3,2-c]pyridin-5(4H)-yl)éthanoate de méthyle sulfate |
| Clopidogrel Hydrogensulfate |
| Thieno[3,2-c]pyridine-5(4H)-acetic acid, α-(2-chlorophenyl)-6,7-dihydro-, methyl ester, (αS)-, sulfate (1:1) |
| (+)-Clopidogrel hydrogen sulfate |
| Clopidogrel bisulphate |
| (S)-(+)-Methyl (2-chlorophenyl)(6,7-dihydro-4H-thieno[3,2-c]pyrid-5-yl)acetate bisulfate |
| Methyl (2S)-(2-chlorophenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)acetate sulfate (1:1) |
| a-(S)-(2-Chlorophenyl)-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-acetic Acid Methyl Ester Sulfate (1:1) |
| Methyl aS-(2-Chlorophenyl)-6,7-dihydrothieno[3,2-c]pyridine-5(4H)-acetate Sulfate (1:1) |
| Methyl-(2S)-(2-chlorphenyl)(6,7-dihydrothieno[3,2-c]pyridin-5(4H)-yl)ethanoatsulfat |
| S-(+)-Clopidogrel Hydrogen Sulfate |