3β-acetoxy-eupha- 7,25-dien-24(R)-ol structure
|
Common Name | 3β-acetoxy-eupha- 7,25-dien-24(R)-ol | ||
|---|---|---|---|---|
| CAS Number | 1352001-09-2 | Molecular Weight | 484.754 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 542.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C32H52O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.1±22.9 °C | |
Use of 3β-acetoxy-eupha- 7,25-dien-24(R)-ol(3β,24R)-3-(Acetyloxy)eupha-7,25-dien-24-ol is an euphane triterpene compound isolated from the barks of Broussonetia papyrifera[1]. |
| Name | (3β,24R)-3-(acetyloxy)eupha-7,25-dien-24-ol |
|---|---|
| Synonym | More Synonyms |
| Description | (3β,24R)-3-(Acetyloxy)eupha-7,25-dien-24-ol is an euphane triterpene compound isolated from the barks of Broussonetia papyrifera[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Han-Ting Zhong, et al. Euphane Triterpenes from the Bark of Broussonetia papyrifera. |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 542.3±50.0 °C at 760 mmHg |
| Molecular Formula | C32H52O3 |
| Molecular Weight | 484.754 |
| Flash Point | 195.1±22.9 °C |
| Exact Mass | 484.391632 |
| PSA | 46.53000 |
| LogP | 10.05 |
| Vapour Pressure | 0.0±3.3 mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | AMYYCORMRINIHJ-SZNQYELCSA-N |
| SMILES | C=C(C)C(O)CCC(C)C1CCC2(C)C3=CCC4C(C)(C)C(OC(C)=O)CCC4(C)C3CCC12C |
| Hazard Codes | Xi |
|---|
| Lanosta-7,25-diene-3,24-diol, 3-acetate, (3β,13α,14β,17α,20S,24R)- |
| 3Beta-acetoxy-eupha-7-25-dien-24(R)-ol |
| 3Beta-acetoxy-eupha- 7,25-dien-24(R)-ol |
| (3β,13α,14β,17α,20S,24R)-24-Hydroxylanosta-7,25-dien-3-yl acetate |