poststatin structure
|
Common Name | poststatin | ||
|---|---|---|---|---|
| CAS Number | 135219-43-1 | Molecular Weight | 541.681 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C26H47N5O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of poststatinPoststatin is a pecific prolyl endopeptidase (PEP) inhibitor. Poststatin inhibits bradykinin-degrading enzymes in rat urine[1][2]. |
| Name | N-[(3S)-3-Amino-2-oxopentanoyl]-D-leucyl-N-[(2S,6S)-2,6-diamino-3,7-dimethyl-5-oxooctanoyl]-L-valine |
|---|---|
| Synonym | More Synonyms |
| Description | Poststatin is a pecific prolyl endopeptidase (PEP) inhibitor. Poststatin inhibits bradykinin-degrading enzymes in rat urine[1][2]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C26H47N5O7 |
| Molecular Weight | 541.681 |
| Exact Mass | 541.347534 |
| LogP | 1.91 |
| Index of Refraction | 1.517 |
| InChIKey | UNPBSZUDTFBULK-CZCKBYKRSA-N |
| SMILES | CCC(N)C(=O)C(=O)NC(CC(C)C)C(=O)N(C(=O)C(N)C(C)CC(=O)C(N)C(C)C)C(C(=O)O)C(C)C |
| L-Valine, N-[(3S)-3-amino-1,2-dioxopentyl]-D-leucyl-N-[(2S,6S)-2,6-diamino-3,7-dimethyl-1,5-dioxooctyl]- |
| N-[(3S)-3-Amino-2-oxopentanoyl]-D-leucyl-N-[(2S,6S)-2,6-diamino-3,7-dimethyl-5-oxooctanoyl]-L-valine |