N-[4-(dimethylthiocarbamoyloxy)phenyl]acetamide
Modify Date: 2025-09-19 21:23:06
![N-[4-(dimethylthiocarbamoyloxy)phenyl]acetamide Structure](https://image.chemsrc.com/caspic/165/13522-65-1.png)
N-[4-(dimethylthiocarbamoyloxy)phenyl]acetamide structure
|
Common Name | N-[4-(dimethylthiocarbamoyloxy)phenyl]acetamide | ||
|---|---|---|---|---|
| CAS Number | 13522-65-1 | Molecular Weight | 238.30600 | |
| Density | 1.242g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H14N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | O-(4-acetamidophenyl) N,N-dimethylcarbamothioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.30600 |
| Exact Mass | 238.07800 |
| PSA | 73.66000 |
| LogP | 1.94330 |
| Index of Refraction | 1.621 |
| InChIKey | VIRJIIOVIJIXGG-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(OC(=S)N(C)C)cc1 |
|
~%
N-[4-(dimethylt... CAS#:13522-65-1 |
| Literature: Hoechst Celanese Corporation Patent: US5157142 A1, 1992 ; |
|
~%
N-[4-(dimethylt... CAS#:13522-65-1 |
| Literature: Newman,M.S.; Karnes,H.A. Journal of Organic Chemistry, 1966 , vol. 31, p. 3980 - 3984 |
CAS#:1126-81-4![N-[4-(dimethylcarbamoylsulfanyl)phenyl]acetamide structure](https://image.chemsrc.com/caspic/432/13512-00-0.png)
CAS#:13512-00-0| N,N-Dimethyl-thiocarbamidsaeure-O-(4-acetamino-phenylester) |
| O-[4-(acetylamino)phenyl] dimethylcarbamothioate |
| O-(N-acetyl-para-aminophenyl)-N,N-dimethylthiocarbamate |