2-(2-(7-(diethylamino)-2-oxo-2H-chromen-3-yl)vinyl)-1,3,3-trimethyl-3H-indol-1-ium iodide structure
|
Common Name | 2-(2-(7-(diethylamino)-2-oxo-2H-chromen-3-yl)vinyl)-1,3,3-trimethyl-3H-indol-1-ium iodide | ||
|---|---|---|---|---|
| CAS Number | 1352626-59-5 | Molecular Weight | 528.42500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H29IN2O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2-(2-(7-(diethylamino)-2-oxo-2H-chromen-3-yl)vinyl)-1,3,3-trimethyl-3H-indol-1-ium iodide |
|---|
| Molecular Formula | C26H29IN2O2 |
|---|---|
| Molecular Weight | 528.42500 |
| Exact Mass | 528.12700 |
| PSA | 36.46000 |
| LogP | 6.31560 |
| InChIKey | OZKWMKLMZONDEZ-UHFFFAOYSA-M |
| SMILES | CCN(CC)c1ccc2cc(C=CC3=[N+](C)c4ccccc4C3(C)C)c(=O)oc2c1.[I-] |
| Water Solubility | methanol: soluble1mg/mL, clear (violet to deep violet) |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
|
Ratiometric fluorescence detection of cyanide based on a hybrid coumarin-hemicyanine dye: the large emission shift and the high selectivity.
Chem. Commun. (Camb.) 47(48) , 12843-5, (2011) A new ratiometric fluorescent cyanide probe was developed based on the nucleophilic attack of CN(-) toward the indolium group of a hybrid coumarin-hemicyanine dye, by which high selectivity as well as... |