Isopropylphosphonic acid ethyl p-nitrophenyl ester structure
|
Common Name | Isopropylphosphonic acid ethyl p-nitrophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 13538-10-8 | Molecular Weight | 273.22200 | |
| Density | 1.229g/cm3 | Boiling Point | 375.9ºC at 760 mmHg | |
| Molecular Formula | C11H16NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 181.1ºC | |
| Name | 1-[ethoxy(propan-2-yl)phosphoryl]oxy-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.229g/cm3 |
|---|---|
| Boiling Point | 375.9ºC at 760 mmHg |
| Molecular Formula | C11H16NO5P |
| Molecular Weight | 273.22200 |
| Flash Point | 181.1ºC |
| Exact Mass | 273.07700 |
| PSA | 91.16000 |
| LogP | 4.13480 |
| Vapour Pressure | 1.63E-05mmHg at 25°C |
| Index of Refraction | 1.511 |
| InChIKey | LRKIJHNJIXGRCI-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(Oc1ccc([N+](=O)[O-])cc1)C(C)C |
| HS Code | 2931900090 |
|---|
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Ethyl p-nitrophenyl isopropylphosphonate |
| ethyl 4-nitrophenyl propan-2-ylphosphonate |
| 1-(ethoxy-propan-2-yl-phosphoryl)oxy-4-nitro-benzene |
| Isopropyl-phosphonsaeure-aethylester-(4-nitro-phenylester) |
| Phosphonic acid,isopropyl-,ethyl p-nitrophenyl ester |
| isopropyl-phosphonic acid ethyl ester-(4-nitro-phenyl ester) |