Benzylphosphonic acid ethyl p-nitrophenyl ester
Modify Date: 2025-10-28 10:00:07
Benzylphosphonic acid ethyl p-nitrophenyl ester structure
|
Common Name | Benzylphosphonic acid ethyl p-nitrophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 3015-70-1 | Molecular Weight | 321.26500 | |
| Density | 1.287g/cm3 | Boiling Point | 465.7ºC at 760mmHg | |
| Molecular Formula | C15H16NO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.4ºC | |
| Name | 1-[benzyl(ethoxy)phosphoryl]oxy-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.287g/cm3 |
|---|---|
| Boiling Point | 465.7ºC at 760mmHg |
| Molecular Formula | C15H16NO5P |
| Molecular Weight | 321.26500 |
| Flash Point | 235.4ºC |
| Exact Mass | 321.07700 |
| PSA | 91.16000 |
| LogP | 4.92660 |
| Index of Refraction | 1.569 |
| InChIKey | XLRKDDZTBFVOSU-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(Cc1ccccc1)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2931900090 |
|---|
|
~%
Benzylphosphoni... CAS#:3015-70-1 |
| Literature: Fukuto; Metcalf Journal of the American Chemical Society, 1959 , vol. 81, p. 372,374 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| ethyl 4-nitrophenyl benzylphosphonate |
| p-Nitrophenyl ethyl benzylphosphonate |
| Phosphonic acid,benzyl-,ethyl p-nitrophenyl ester |