Sulfanitran-13C6 structure
|
Common Name | Sulfanitran-13C6 | ||
|---|---|---|---|---|
| CAS Number | 1353867-79-4 | Molecular Weight | 341.291 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C813C6H13N3O5S | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
Use of Sulfanitran-13C6Sulfanitran-13C6 is the 13C6 labeled Sulfanitran. Sulfanitran is an antibacterial and anticoccidial agent used in poultry feeds. Sulfanitran also is a multidrug resistance protein 2 (MRP2) stimulator that can increase the affinity of MRP2 for estradiol-17-β-D-glucuronide (E217βG). |
| Name | Sulfanitran-13C6 |
|---|---|
| Synonym | More Synonyms |
| Description | Sulfanitran-13C6 is the 13C6 labeled Sulfanitran. Sulfanitran is an antibacterial and anticoccidial agent used in poultry feeds. Sulfanitran also is a multidrug resistance protein 2 (MRP2) stimulator that can increase the affinity of MRP2 for estradiol-17-β-D-glucuronide (E217βG). |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C813C6H13N3O5S |
| Molecular Weight | 341.291 |
| Exact Mass | 341.077728 |
| Index of Refraction | 1.665 |
| InChIKey | GWBPFRGXNGPPMF-BWWUJVEXSA-N |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)Nc2ccc([N+](=O)[O-])cc2)cc1 |
| RIDADR | NONH for all modes of transport |
|---|
| N-[4-(4-Nitrophenylsulfamoyl)phenyl-13C6]acetamide |
| Sulfanitran-(sulfanilamide ring-13C6) |
| N-{4-[(4-Nitrophenyl)sulfamoyl](13C6)phenyl}acetamide |
| N4-Acetyl-N1-(4-nitrophenyl)sulfanilamide-13C6 |
| Acetamide, N-[4-[[(4-nitrophenyl)amino]sulfonyl]phenyl-1,2,3,4,5,6-13C6]- |
| MFCD20527277 |