Rehmapicrogenin structure
|
Common Name | Rehmapicrogenin | ||
|---|---|---|---|---|
| CAS Number | 135447-39-1 | Molecular Weight | 184.23200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RehmapicrogeninRehmapicrogenin, isolated from the root of Rehmannia glutinosa, exhibits potent anti-inflammatory effect by inhibiting iNOS, COX-2 and IL-6[1]. |
| Name | 3-hydroxy-2,6,6-trimethyl-1-cyclohexene-1-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Rehmapicrogenin, isolated from the root of Rehmannia glutinosa, exhibits potent anti-inflammatory effect by inhibiting iNOS, COX-2 and IL-6[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C10H16O3 |
|---|---|
| Molecular Weight | 184.23200 |
| Exact Mass | 184.11000 |
| PSA | 57.53000 |
| LogP | 1.56840 |
| InChIKey | IJTFWVKHFTZVSR-SSDOTTSWSA-N |
| SMILES | CC1=C(C(=O)O)C(C)(C)CCC1O |
| Storage condition | 2-8℃ |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| rehmapicrogenin |
| .1.1.3-Trimethyl-cyclohexen-(2)-ol-(4)-carbonsaeure-(2) |
| .Oxy- |
| .3-hydroxy-2,6,6-trimethyl-cyclohex-1-enecarboxylic acid |
| .3-Hydroxy-2,6,6-trimethyl-cyclohex-1-encarbonsaeure |