6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one
Modify Date: 2025-11-25 17:21:00
![6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one Structure](https://image.chemsrc.com/caspic/272/1355152-77-0.png)
6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one structure
|
Common Name | 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 1355152-77-0 | Molecular Weight | 470.36100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H20BrN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H20BrN3O |
|---|---|
| Molecular Weight | 470.36100 |
| Exact Mass | 469.07900 |
| PSA | 39.82000 |
| LogP | 5.33770 |
| InChIKey | ZTSKGNVGCSZGEG-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)n(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ncc(Br)cc21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
![2-HYDROXY-1-METHYL-6-PHENYLIMIDAZO[4,5-B]PYRIDINE structure](https://image.chemsrc.com/caspic/139/120889-04-5.png)
CAS#:120889-04-5This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one? |
| A: The English name of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one is 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one. |
| Q: What is the InChIKey of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one? |
| A: InChIKey of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one is ZTSKGNVGCSZGEG-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one? |
| A: SMILES notation of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one is Cn1c(=O)n(C(c2ccccc2)(c2ccccc2)c2ccccc2)c2ncc(Br)cc21. |
| Q: What is the molecular weight of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one? |
| A: Molecular weight of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one is 470.36100. |
| Q: What is the CAS number of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one? |
| A: CAS number of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one is 1355152-77-0. |
| Q: What is the Chinese name of 1355152-77-0? |
| A: Chinese name of 1355152-77-0 is 1355152-77-0. |
| Q: What is the molecular formula of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one? |
| A: Molecular formula of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one is C26H20BrN3O. |
| Q: What are the downstream products of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one? |
| A: Related downstream products(CAS) of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one: 120889-04-5. |
| Q: What is the LogP of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one? |
| A: LogP of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one is 5.33770. |
| Q: What is the polar surface area (PSA) of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one? |
| A: Polar surface area (PSA) of 6-bromo-1-methyl-3-trityl-1H-imidazo[4,5-b]pyridin-2(3H)-one is 39.82000. |