1,3-Diazidobenzene structure
|
Common Name | 1,3-Diazidobenzene | ||
|---|---|---|---|---|
| CAS Number | 13556-50-8 | Molecular Weight | 160.13600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H4N6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-Diazidobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6H4N6 |
|---|---|
| Molecular Weight | 160.13600 |
| Exact Mass | 160.05000 |
| PSA | 99.50000 |
| LogP | 2.47572 |
| InChIKey | XNRIPCDSMGRSPE-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1cccc(N=[N+]=[N-])c1 |
|
~60%
1,3-Diazidobenzene CAS#:13556-50-8 |
| Literature: Chapyshev, Sergei Viktorovich; Tomioko, Hideo Bulletin of the Chemical Society of Japan, 2003 , vol. 76, # 11 p. 2075 - 2090 |
|
~%
1,3-Diazidobenzene CAS#:13556-50-8 |
| Literature: Forster; Fierz Journal of the Chemical Society, 1907 , vol. 91, p. 1952 |
|
~%
1,3-Diazidobenzene CAS#:13556-50-8 |
| Literature: Schoutissen Recueil des Travaux Chimiques des Pays-Bas, 1933 , vol. 52, p. 869,872 |
| Benzene,1,3-diazido |
| 1,3-Diazido-benzol |
| n-phenylenediazide |
| 1,3-diazido-benzene |
| XNRIPCDSMGRSPE-UHFFFAOYSA |
| m-phenylenediazide |
| m-diazidobenzene |
| m-Phenylen-diazid |